C32H33N3O2 — CID 4610410
N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-2-[2-(naphthalen-1-ylmethyl)benzimidazol-1-yl]acetamide (PubChem CID 4610410) has the molecular formula C32H33N3O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-2-[2-(naphthalen-1-ylmethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-2-[2-(naphthalen-1-ylmethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 4610410 |
| Molecular Formula | C32H33N3O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-2-[2-(naphthalen-1-ylmethyl)benzimidazol-1-yl]acetamide |
| SMILES | CCOCN(C(=O)Cn1c(Cc2cccc3ccccc23)nc2ccccc21)c1c(C)cccc1CC |
| InChI | InChI=1S/C32H33N3O2/c1-4-24-14-10-12-23(3)32(24)35(22-37-5-2)31(36)21-34-29-19-9-8-18-28(29)33-30(34)20-26-16-11-15-25-13-6-7-17-27(25)26/h6-19H,4-5,20-22H2,1-3H3 |
| InChIKey | YAQZZSKONXTLBE-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|