C29H33N3O4 — CID 23905961
N-(2,6-diethylphenyl)-N-(methoxymethyl)-2-[2-[(4-methoxyphenoxy)methyl]benzimidazol-1-yl]acetamide (PubChem CID 23905961) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-N-(methoxymethyl)-2-[2-[(4-methoxyphenoxy)methyl]benzimidazol-1-yl]acetamide.
| Compound Name | N-(2,6-diethylphenyl)-N-(methoxymethyl)-2-[2-[(4-methoxyphenoxy)methyl]benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 23905961 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | N-(2,6-diethylphenyl)-N-(methoxymethyl)-2-[2-[(4-methoxyphenoxy)methyl]benzimidazol-1-yl]acetamide |
| SMILES | CCc1cccc(CC)c1N(COC)C(=O)Cn1c(COc2ccc(OC)cc2)nc2ccccc21 |
| InChI | InChI=1S/C29H33N3O4/c1-5-21-10-9-11-22(6-2)29(21)32(20-34-3)28(33)18-31-26-13-8-7-12-25(26)30-27(31)19-36-24-16-14-23(35-4)15-17-24/h7-17H,5-6,18-20H2,1-4H3 |
| InChIKey | VYLGURSQUJOUMO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|