C32H39N3O3 — CID 3738589
2-[2-[(4-tert-butylphenoxy)methyl]benzimidazol-1-yl]-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide (PubChem CID 3738589) has the molecular formula C32H39N3O3 and a molecular weight of 513.68 g/mol. Its IUPAC name is 2-[2-[(4-tert-butylphenoxy)methyl]benzimidazol-1-yl]-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide.
| Compound Name | 2-[2-[(4-tert-butylphenoxy)methyl]benzimidazol-1-yl]-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 3738589 |
| Molecular Formula | C32H39N3O3 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | 2-[2-[(4-tert-butylphenoxy)methyl]benzimidazol-1-yl]-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide |
| SMILES | CCOCN(C(=O)Cn1c(COc2ccc(C(C)(C)C)cc2)nc2ccccc21)c1c(C)cccc1CC |
| InChI | InChI=1S/C32H39N3O3/c1-7-24-13-11-12-23(3)31(24)35(22-37-8-2)30(36)20-34-28-15-10-9-14-27(28)33-29(34)21-38-26-18-16-25(17-19-26)32(4,5)6/h9-19H,7-8,20-22H2,1-6H3 |
| InChIKey | MXTFMYPARFPZAF-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|