C20H30N4O3 — CID 162196373
5-[3-(4-carbamimidoylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-8-yl]pentanoic acid;methane (PubChem CID 162196373) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 5-[3-(4-carbamimidoylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-8-yl]pentanoic acid;methane.
| Compound Name | 5-[3-(4-carbamimidoylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-8-yl]pentanoic acid;methane |
|---|---|
| PubChem CID | 162196373 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 5-[3-(4-carbamimidoylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-8-yl]pentanoic acid;methane |
| SMILES | C.[H]/N=C(\N)c1ccc(C2=NOC3(CCN(CCCCC(=O)O)CC3)C2)cc1 |
| InChI | InChI=1S/C19H26N4O3.CH4/c20-18(21)15-6-4-14(5-7-15)16-13-19(26-22-16)8-11-23(12-9-19)10-2-1-3-17(24)25;/h4-7H,1-3,8-13H2,(H3,20,21)(H,24,25);1H4 |
| InChIKey | ZQZKTEYVQJFQAA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 112.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|