C20H28N4O4 — CID 23435669
ethyl 4-[3-(4-carbamimidoylphenyl)-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl]butanoate (PubChem CID 23435669) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is ethyl 4-[3-(4-carbamimidoylphenyl)-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl]butanoate.
| Compound Name | ethyl 4-[3-(4-carbamimidoylphenyl)-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl]butanoate |
|---|---|
| PubChem CID | 23435669 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | ethyl 4-[3-(4-carbamimidoylphenyl)-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl]butanoate |
| SMILES | [H]/N=C(\N)c1ccc(N2CC3(CCN(CCCC(=O)OCC)CC3)OC2=O)cc1 |
| InChI | InChI=1S/C20H28N4O4/c1-2-27-17(25)4-3-11-23-12-9-20(10-13-23)14-24(19(26)28-20)16-7-5-15(6-8-16)18(21)22/h5-8H,2-4,9-14H2,1H3,(H3,21,22) |
| InChIKey | IDCHIVVPYUPNRT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|