C19H28N4O4 — CID 70118799
3-[4-[[3-(4-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]methyl]-4-hydroxypiperidin-1-yl]propanoic acid (PubChem CID 70118799) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-[4-[[3-(4-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]methyl]-4-hydroxypiperidin-1-yl]propanoic acid.
| Compound Name | 3-[4-[[3-(4-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]methyl]-4-hydroxypiperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 70118799 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 3-[4-[[3-(4-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]methyl]-4-hydroxypiperidin-1-yl]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C2CC(CC3(O)CCN(CCC(=O)O)CC3)ON2)cc1 |
| InChI | InChI=1S/C19H28N4O4/c20-18(21)14-3-1-13(2-4-14)16-11-15(27-22-16)12-19(26)6-9-23(10-7-19)8-5-17(24)25/h1-4,15-16,22,26H,5-12H2,(H3,20,21)(H,24,25) |
| InChIKey | LXGSWYHNUJGQKV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|