C20H30N4O4 — CID 57104446
methyl 5-[[2-[(3S,5R)-3-(4-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]acetyl]amino]heptanoate (PubChem CID 57104446) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is methyl 5-[[2-[(3S,5R)-3-(4-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]acetyl]amino]heptanoate.
| Compound Name | methyl 5-[[2-[(3S,5R)-3-(4-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]acetyl]amino]heptanoate |
|---|---|
| PubChem CID | 57104446 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | methyl 5-[[2-[(3S,5R)-3-(4-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]acetyl]amino]heptanoate |
| SMILES | [H]/N=C(\N)c1ccc([C@@H]2C[C@H](CC(=O)NC(CC)CCCC(=O)OC)ON2)cc1 |
| InChI | InChI=1S/C20H30N4O4/c1-3-15(5-4-6-19(26)27-2)23-18(25)12-16-11-17(24-28-16)13-7-9-14(10-8-13)20(21)22/h7-10,15-17,24H,3-6,11-12H2,1-2H3,(H3,21,22)(H,23,25)/t15?,16-,17+/m1/s1 |
| InChIKey | BNOMCOCBWGCLMO-FGJGXXMFSA-N |
| XLogP | 1.93 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|