C20H32N4O2 — CID 57018794
N-[(3S)-6-[[2-(4-carbamimidoylphenyl)acetyl]amino]hexan-3-yl]-3-methylbutanamide (PubChem CID 57018794) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[(3S)-6-[[2-(4-carbamimidoylphenyl)acetyl]amino]hexan-3-yl]-3-methylbutanamide.
| Compound Name | N-[(3S)-6-[[2-(4-carbamimidoylphenyl)acetyl]amino]hexan-3-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 57018794 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | N-[(3S)-6-[[2-(4-carbamimidoylphenyl)acetyl]amino]hexan-3-yl]-3-methylbutanamide |
| SMILES | [H]/N=C(\N)c1ccc(CC(=O)NCCC[C@H](CC)NC(=O)CC(C)C)cc1 |
| InChI | InChI=1S/C20H32N4O2/c1-4-17(24-19(26)12-14(2)3)6-5-11-23-18(25)13-15-7-9-16(10-8-15)20(21)22/h7-10,14,17H,4-6,11-13H2,1-3H3,(H3,21,22)(H,23,25)(H,24,26)/t17-/m0/s1 |
| InChIKey | QXOKRFGKQOKOLF-KRWDZBQOSA-N |
| XLogP | 2.35 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|