C23H26N4O4 — CID 10740913
methyl (3R)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-4-phenylbutanoate (PubChem CID 10740913) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is methyl (3R)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-4-phenylbutanoate.
| Compound Name | methyl (3R)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 10740913 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | methyl (3R)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-4-phenylbutanoate |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC(CC(=O)N[C@@H](CC(=O)OC)Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C23H26N4O4/c1-30-22(29)12-18(11-15-5-3-2-4-6-15)26-21(28)14-19-13-20(27-31-19)16-7-9-17(10-8-16)23(24)25/h2-10,18-19H,11-14H2,1H3,(H3,24,25)(H,26,28)/t18-,19?/m1/s1 |
| InChIKey | FTMGIHMHMFXUMV-MRTLOADZSA-N |
| XLogP | 2.14 |
| TPSA | 126.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|