C19H20N4O4S — CID 135836163
(2R)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-2-thiophen-2-ylpropanoic acid (PubChem CID 135836163) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is (2R)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-2-thiophen-2-ylpropanoic acid.
| Compound Name | (2R)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-2-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 135836163 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (2R)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-2-thiophen-2-ylpropanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC(CC(=O)NC[C@H](C(=O)O)c3cccs3)C2)cc1 |
| InChI | InChI=1S/C19H20N4O4S/c20-18(21)12-5-3-11(4-6-12)15-8-13(27-23-15)9-17(24)22-10-14(19(25)26)16-2-1-7-28-16/h1-7,13-14H,8-10H2,(H3,20,21)(H,22,24)(H,25,26)/t13?,14-/m0/s1 |
| InChIKey | JKSVHEPZXZVQNA-KZUDCZAMSA-N |
| XLogP | 1.90 |
| TPSA | 137.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|