C17H22N4O3 — CID 20662942
2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-N-(2-methyl-3-oxobutyl)acetamide (PubChem CID 20662942) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-N-(2-methyl-3-oxobutyl)acetamide.
| Compound Name | 2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-N-(2-methyl-3-oxobutyl)acetamide |
|---|---|
| PubChem CID | 20662942 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-N-(2-methyl-3-oxobutyl)acetamide |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC(CC(=O)NCC(C)C(C)=O)C2)cc1 |
| InChI | InChI=1S/C17H22N4O3/c1-10(11(2)22)9-20-16(23)8-14-7-15(21-24-14)12-3-5-13(6-4-12)17(18)19/h3-6,10,14H,7-9H2,1-2H3,(H3,18,19)(H,20,23) |
| InChIKey | RBLXZDOZPULGFV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|