C19H24N4O5 — CID 91238871
[(E)-[amino-[4-[5-[2-[(2-methyl-3-oxobutyl)amino]-2-oxoethyl]-4,5-dihydro-1,2-oxazol-3-yl]phenyl]methylidene]amino] acetate (PubChem CID 91238871) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is [(E)-[amino-[4-[5-[2-[(2-methyl-3-oxobutyl)amino]-2-oxoethyl]-4,5-dihydro-1,2-oxazol-3-yl]phenyl]methylidene]amino] acetate.
| Compound Name | [(E)-[amino-[4-[5-[2-[(2-methyl-3-oxobutyl)amino]-2-oxoethyl]-4,5-dihydro-1,2-oxazol-3-yl]phenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 91238871 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [(E)-[amino-[4-[5-[2-[(2-methyl-3-oxobutyl)amino]-2-oxoethyl]-4,5-dihydro-1,2-oxazol-3-yl]phenyl]methylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(/N)c1ccc(C2=NOC(CC(=O)NCC(C)C(C)=O)C2)cc1 |
| InChI | InChI=1S/C19H24N4O5/c1-11(12(2)24)10-21-18(26)9-16-8-17(22-28-16)14-4-6-15(7-5-14)19(20)23-27-13(3)25/h4-7,11,16H,8-10H2,1-3H3,(H2,20,23)(H,21,26) |
| InChIKey | GYNOSAXMMVUMFE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 132.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|