C17H22N4O4 — CID 135723112
2-[3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-(2-methyl-3-oxobutyl)acetamide (PubChem CID 135723112) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-[3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-(2-methyl-3-oxobutyl)acetamide.
| Compound Name | 2-[3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-(2-methyl-3-oxobutyl)acetamide |
|---|---|
| PubChem CID | 135723112 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-[3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-(2-methyl-3-oxobutyl)acetamide |
| SMILES | CC(=O)C(C)CNC(=O)CC1CC(c2ccc(/C(N)=N/O)cc2)=NO1 |
| InChI | InChI=1S/C17H22N4O4/c1-10(11(2)22)9-19-16(23)8-14-7-15(21-25-14)12-3-5-13(6-4-12)17(18)20-24/h3-6,10,14,24H,7-9H2,1-2H3,(H2,18,20)(H,19,23) |
| InChIKey | FTTVHLOMOPFVPR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|