C15H19N5O4 — CID 152763441
(2S)-2,3-diamino-5-[(5S)-3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-4-oxopentanoic acid (PubChem CID 152763441) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is (2S)-2,3-diamino-5-[(5S)-3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-4-oxopentanoic acid.
| Compound Name | (2S)-2,3-diamino-5-[(5S)-3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 152763441 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (2S)-2,3-diamino-5-[(5S)-3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-4-oxopentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C2=NO[C@H](CC(=O)C(N)[C@H](N)C(=O)O)C2)cc1 |
| InChI | InChI=1S/C15H19N5O4/c16-12(13(17)15(22)23)11(21)6-9-5-10(20-24-9)7-1-3-8(4-2-7)14(18)19/h1-4,9,12-13H,5-6,16-17H2,(H3,18,19)(H,22,23)/t9-,12?,13-/m0/s1 |
| InChIKey | LZJNWVHLSXALNH-SKGBEAKQSA-N |
| XLogP | -0.84 |
| TPSA | 177.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|