C26H33N5O5 — CID 74988760
4-(2-adamantylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-4-oxobutanoic acid (PubChem CID 74988760) has the molecular formula C26H33N5O5 and a molecular weight of 495.58 g/mol. Its IUPAC name is 4-(2-adamantylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-(2-adamantylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 74988760 |
| Molecular Formula | C26H33N5O5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 4-(2-adamantylamino)-3-[[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]-4-oxobutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC(CC(=O)NC(CC(=O)O)C(=O)NC3C4CC5CC(C4)CC3C5)C2)cc1 |
| InChI | InChI=1S/C26H33N5O5/c27-25(28)16-3-1-15(2-4-16)20-10-19(36-31-20)11-22(32)29-21(12-23(33)34)26(35)30-24-17-6-13-5-14(8-17)9-18(24)7-13/h1-4,13-14,17-19,21,24H,5-12H2,(H3,27,28)(H,29,32)(H,30,35)(H,33,34) |
| InChIKey | ORUVMYFFAUIEFT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 166.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|