C17H23N3O5 — CID 54375613
2-[(3S,5R)-3-(4-butoxycarbonyl-2-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]acetic acid (PubChem CID 54375613) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-[(3S,5R)-3-(4-butoxycarbonyl-2-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]acetic acid.
| Compound Name | 2-[(3S,5R)-3-(4-butoxycarbonyl-2-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 54375613 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-[(3S,5R)-3-(4-butoxycarbonyl-2-carbamimidoylphenyl)-1,2-oxazolidin-5-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1cc(C(=O)OCCCC)ccc1[C@@H]1C[C@H](CC(=O)O)ON1 |
| InChI | InChI=1S/C17H23N3O5/c1-2-3-6-24-17(23)10-4-5-12(13(7-10)16(18)19)14-8-11(25-20-14)9-15(21)22/h4-5,7,11,14,20H,2-3,6,8-9H2,1H3,(H3,18,19)(H,21,22)/t11-,14+/m1/s1 |
| InChIKey | UWGYRHWKKADSKI-RISCZKNCSA-N |
| XLogP | 1.74 |
| TPSA | 134.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|