C19H23N5O7 — CID 10670418
2-[(2S)-1-[2-[(4-carbamimidoylbenzoyl)amino]acetyl]-4-(2-methoxy-2-oxoethyl)-3-oxopiperazin-2-yl]acetic acid (PubChem CID 10670418) has the molecular formula C19H23N5O7 and a molecular weight of 433.42 g/mol. Its IUPAC name is 2-[(2S)-1-[2-[(4-carbamimidoylbenzoyl)amino]acetyl]-4-(2-methoxy-2-oxoethyl)-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[(2S)-1-[2-[(4-carbamimidoylbenzoyl)amino]acetyl]-4-(2-methoxy-2-oxoethyl)-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 10670418 |
| Molecular Formula | C19H23N5O7 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 2-[(2S)-1-[2-[(4-carbamimidoylbenzoyl)amino]acetyl]-4-(2-methoxy-2-oxoethyl)-3-oxopiperazin-2-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NCC(=O)N2CCN(CC(=O)OC)C(=O)[C@@H]2CC(=O)O)cc1 |
| InChI | InChI=1S/C19H23N5O7/c1-31-16(28)10-23-6-7-24(13(19(23)30)8-15(26)27)14(25)9-22-18(29)12-4-2-11(3-5-12)17(20)21/h2-5,13H,6-10H2,1H3,(H3,20,21)(H,22,29)(H,26,27)/t13-/m0/s1 |
| InChIKey | RXIOXTFLJJOEFS-ZDUSSCGKSA-N |
| XLogP | -1.61 |
| TPSA | 183.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|