C29H35N5O7 — CID 54464068
[2-[3-benzyl-4-[2-[(4-carbamimidoylbenzoyl)amino]acetyl]-2-oxopiperazin-1-yl]acetyl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 54464068) has the molecular formula C29H35N5O7 and a molecular weight of 565.63 g/mol. Its IUPAC name is [2-[3-benzyl-4-[2-[(4-carbamimidoylbenzoyl)amino]acetyl]-2-oxopiperazin-1-yl]acetyl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2-[3-benzyl-4-[2-[(4-carbamimidoylbenzoyl)amino]acetyl]-2-oxopiperazin-1-yl]acetyl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54464068 |
| Molecular Formula | C29H35N5O7 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | [2-[3-benzyl-4-[2-[(4-carbamimidoylbenzoyl)amino]acetyl]-2-oxopiperazin-1-yl]acetyl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NCC(=O)N2CCN(CC(=O)OCOC(=O)C(C)(C)C)C(=O)C2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H35N5O7/c1-29(2,3)28(39)41-18-40-24(36)17-33-13-14-34(22(27(33)38)15-19-7-5-4-6-8-19)23(35)16-32-26(37)21-11-9-20(10-12-21)25(30)31/h4-12,22H,13-18H2,1-3H3,(H3,30,31)(H,32,37) |
| InChIKey | XDQDNAQCHKAWDW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 172.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|