C23H28N4O3 — CID 71563311
2-[(3R)-3-benzyl-2-oxo-4-[2-[[(1R)-1-phenylethyl]amino]acetyl]piperazin-1-yl]acetamide (PubChem CID 71563311) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-[(3R)-3-benzyl-2-oxo-4-[2-[[(1R)-1-phenylethyl]amino]acetyl]piperazin-1-yl]acetamide.
| Compound Name | 2-[(3R)-3-benzyl-2-oxo-4-[2-[[(1R)-1-phenylethyl]amino]acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 71563311 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 2-[(3R)-3-benzyl-2-oxo-4-[2-[[(1R)-1-phenylethyl]amino]acetyl]piperazin-1-yl]acetamide |
| SMILES | C[C@@H](NCC(=O)N1CCN(CC(N)=O)C(=O)[C@H]1Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H28N4O3/c1-17(19-10-6-3-7-11-19)25-15-22(29)27-13-12-26(16-21(24)28)23(30)20(27)14-18-8-4-2-5-9-18/h2-11,17,20,25H,12-16H2,1H3,(H2,24,28)/t17-,20-/m1/s1 |
| InChIKey | XXJSOATZCDADII-YLJYHZDGSA-N |
| XLogP | 1.10 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |