C16H22N4O3 — CID 71563186
2-[2-oxo-4-[2-[[(1R)-1-phenylethyl]amino]acetyl]piperazin-1-yl]acetamide (PubChem CID 71563186) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-[2-oxo-4-[2-[[(1R)-1-phenylethyl]amino]acetyl]piperazin-1-yl]acetamide.
| Compound Name | 2-[2-oxo-4-[2-[[(1R)-1-phenylethyl]amino]acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 71563186 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[2-oxo-4-[2-[[(1R)-1-phenylethyl]amino]acetyl]piperazin-1-yl]acetamide |
| SMILES | C[C@@H](NCC(=O)N1CCN(CC(N)=O)C(=O)C1)c1ccccc1 |
| InChI | InChI=1S/C16H22N4O3/c1-12(13-5-3-2-4-6-13)18-9-15(22)20-8-7-19(10-14(17)21)16(23)11-20/h2-6,12,18H,7-11H2,1H3,(H2,17,21)/t12-/m1/s1 |
| InChIKey | CPAJAFZJBTWWJY-GFCCVEGCSA-N |
| XLogP | -0.51 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |