C21H20N4O3 — CID 68787822
3-[4-(aminomethyl)phenoxy]-5-(4-carbamimidoylphenoxy)benzamide (PubChem CID 68787822) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 3-[4-(aminomethyl)phenoxy]-5-(4-carbamimidoylphenoxy)benzamide.
| Compound Name | 3-[4-(aminomethyl)phenoxy]-5-(4-carbamimidoylphenoxy)benzamide |
|---|---|
| PubChem CID | 68787822 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 3-[4-(aminomethyl)phenoxy]-5-(4-carbamimidoylphenoxy)benzamide |
| SMILES | [H]/N=C(\N)c1ccc(Oc2cc(Oc3ccc(CN)cc3)cc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C21H20N4O3/c22-12-13-1-5-16(6-2-13)27-18-9-15(21(25)26)10-19(11-18)28-17-7-3-14(4-8-17)20(23)24/h1-11H,12,22H2,(H3,23,24)(H2,25,26) |
| InChIKey | YAWMBRXBPFOWEY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|