C15H17BO5 — CID 75486500
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxylic acid (PubChem CID 75486500) has the molecular formula C15H17BO5 and a molecular weight of 288.11 g/mol. Its IUPAC name is 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxylic acid.
| Compound Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 75486500 |
| Molecular Formula | C15H17BO5 |
| Molecular Weight | 288.11 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxylic acid |
| SMILES | CC1(C)OB(c2cccc3cc(C(=O)O)oc23)OC1(C)C |
| InChI | InChI=1S/C15H17BO5/c1-14(2)15(3,4)21-16(20-14)10-7-5-6-9-8-11(13(17)18)19-12(9)10/h5-8H,1-4H3,(H,17,18) |
| InChIKey | AVIFXXLGMLBCBA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.11 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|