C17H20F3NO5 — CID 175665851
(E)-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-2-(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 175665851) has the molecular formula C17H20F3NO5 and a molecular weight of 375.34 g/mol. Its IUPAC name is (E)-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-2-(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-2-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175665851 |
| Molecular Formula | C17H20F3NO5 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (E)-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-2-(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc(/C=C/C(=O)O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H20F3NO5/c1-16(2,3)26-15(24)21-8-9-25-12-6-4-11(5-7-14(22)23)13(10-12)17(18,19)20/h4-7,10H,8-9H2,1-3H3,(H,21,24)(H,22,23)/b7-5+ |
| InChIKey | HMUUIQBMCKNQPM-FNORWQNLSA-N |
| XLogP | 3.71 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|