C28H31B2NO4 — CID 70670361
3-[3-[3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine (PubChem CID 70670361) has the molecular formula C28H31B2NO4 and a molecular weight of 467.18 g/mol. Its IUPAC name is 3-[3-[3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine.
| Compound Name | 3-[3-[3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 70670361 |
| Molecular Formula | C28H31B2NO4 |
| Molecular Weight | 467.18 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 3-[3-[3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine |
| SMILES | C=C1OB(c2cc(B3OC(C)(C)C(C)(C)O3)cc(-c3cccc(-c4cccnc4)c3)c2)OC1(C)C |
| InChI | InChI=1S/C28H31B2NO4/c1-19-26(2,3)33-29(32-19)24-15-23(16-25(17-24)30-34-27(4,5)28(6,7)35-30)21-11-8-10-20(14-21)22-12-9-13-31-18-22/h8-18H,1H2,2-7H3 |
| InChIKey | LYZOSHAUSWLUPU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.18 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|