C25H26BNO2 — CID 88986134
4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-N,N-bis(4-methylphenyl)aniline (PubChem CID 88986134) has the molecular formula C25H26BNO2 and a molecular weight of 383.30 g/mol. Its IUPAC name is 4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-N,N-bis(4-methylphenyl)aniline.
| Compound Name | 4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-N,N-bis(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 88986134 |
| Molecular Formula | C25H26BNO2 |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-N,N-bis(4-methylphenyl)aniline |
| SMILES | C=C1OB(c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C25H26BNO2/c1-18-6-12-22(13-7-18)27(23-14-8-19(2)9-15-23)24-16-10-21(11-17-24)26-28-20(3)25(4,5)29-26/h6-17H,3H2,1-2,4-5H3 |
| InChIKey | BNCJTFBPXYKSCV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|