C11H15BN2O2 — CID 89018622
5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-6-methylpyridin-2-amine (PubChem CID 89018622) has the molecular formula C11H15BN2O2 and a molecular weight of 218.06 g/mol. Its IUPAC name is 5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-6-methylpyridin-2-amine.
| Compound Name | 5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-6-methylpyridin-2-amine |
|---|---|
| PubChem CID | 89018622 |
| Molecular Formula | C11H15BN2O2 |
| Molecular Weight | 218.06 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-6-methylpyridin-2-amine |
| SMILES | C=C1OB(c2ccc(N)nc2C)OC1(C)C |
| InChI | InChI=1S/C11H15BN2O2/c1-7-9(5-6-10(13)14-7)12-15-8(2)11(3,4)16-12/h5-6H,2H2,1,3-4H3,(H2,13,14) |
| InChIKey | FFBHKKJCKSTUMX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.06 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|