C10H13BN2O3 — CID 89216792
2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-6-methoxypyrazine (PubChem CID 89216792) has the molecular formula C10H13BN2O3 and a molecular weight of 220.04 g/mol. Its IUPAC name is 2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-6-methoxypyrazine.
| Compound Name | 2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-6-methoxypyrazine |
|---|---|
| PubChem CID | 89216792 |
| Molecular Formula | C10H13BN2O3 |
| Molecular Weight | 220.04 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-6-methoxypyrazine |
| SMILES | C=C1OB(c2cncc(OC)n2)OC1(C)C |
| InChI | InChI=1S/C10H13BN2O3/c1-7-10(2,3)16-11(15-7)8-5-12-6-9(13-8)14-4/h5-6H,1H2,2-4H3 |
| InChIKey | SIVVFLYUAMGNKG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.04 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|