C12H18BN3O3 — CID 70214724
5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-N-ethyl-4-methoxypyrimidin-2-amine (PubChem CID 70214724) has the molecular formula C12H18BN3O3 and a molecular weight of 263.11 g/mol. Its IUPAC name is 5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-N-ethyl-4-methoxypyrimidin-2-amine.
| Compound Name | 5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-N-ethyl-4-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 70214724 |
| Molecular Formula | C12H18BN3O3 |
| Molecular Weight | 263.11 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-N-ethyl-4-methoxypyrimidin-2-amine |
| SMILES | C=C1OB(c2cnc(NCC)nc2OC)OC1(C)C |
| InChI | InChI=1S/C12H18BN3O3/c1-6-14-11-15-7-9(10(16-11)17-5)13-18-8(2)12(3,4)19-13/h7H,2,6H2,1,3-5H3,(H,14,15,16) |
| InChIKey | AYICVYVBOBITQR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.11 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|