C11H13N5O — CID 114273065
N-ethyl-5-(3-methoxypyrazin-2-yl)pyrimidin-2-amine (PubChem CID 114273065) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is N-ethyl-5-(3-methoxypyrazin-2-yl)pyrimidin-2-amine.
| Compound Name | N-ethyl-5-(3-methoxypyrazin-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114273065 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | N-ethyl-5-(3-methoxypyrazin-2-yl)pyrimidin-2-amine |
| SMILES | CCNc1ncc(-c2nccnc2OC)cn1 |
| InChI | InChI=1S/C11H13N5O/c1-3-12-11-15-6-8(7-16-11)9-10(17-2)14-5-4-13-9/h4-7H,3H2,1-2H3,(H,12,15,16) |
| InChIKey | XYAHCXAEMKQAII-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |