C12H15N5O — CID 104516646
6-(3-methoxypyrazin-2-yl)-N,4,5-trimethylpyridazin-3-amine (PubChem CID 104516646) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is 6-(3-methoxypyrazin-2-yl)-N,4,5-trimethylpyridazin-3-amine.
| Compound Name | 6-(3-methoxypyrazin-2-yl)-N,4,5-trimethylpyridazin-3-amine |
|---|---|
| PubChem CID | 104516646 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 6-(3-methoxypyrazin-2-yl)-N,4,5-trimethylpyridazin-3-amine |
| SMILES | CNc1nnc(-c2nccnc2OC)c(C)c1C |
| InChI | InChI=1S/C12H15N5O/c1-7-8(2)11(13-3)17-16-9(7)10-12(18-4)15-6-5-14-10/h5-6H,1-4H3,(H,13,17) |
| InChIKey | REIFCFKIGOEENI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |