C8H6ClN3OS — CID 104516513
4-chloro-2-(3-methoxypyrazin-2-yl)-1,3-thiazole (PubChem CID 104516513) has the molecular formula C8H6ClN3OS and a molecular weight of 227.68 g/mol. Its IUPAC name is 4-chloro-2-(3-methoxypyrazin-2-yl)-1,3-thiazole.
| Compound Name | 4-chloro-2-(3-methoxypyrazin-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 104516513 |
| Molecular Formula | C8H6ClN3OS |
| Molecular Weight | 227.68 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 4-chloro-2-(3-methoxypyrazin-2-yl)-1,3-thiazole |
| SMILES | COc1nccnc1-c1nc(Cl)cs1 |
| InChI | InChI=1S/C8H6ClN3OS/c1-13-7-6(10-2-3-11-7)8-12-5(9)4-14-8/h2-4H,1H3 |
| InChIKey | WQVFMZYUWAMAGQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.68 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |