C13H13BBrNO2 — CID 67576474
7-bromo-2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-1H-indole (PubChem CID 67576474) has the molecular formula C13H13BBrNO2 and a molecular weight of 305.97 g/mol. Its IUPAC name is 7-bromo-2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-1H-indole.
| Compound Name | 7-bromo-2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-1H-indole |
|---|---|
| PubChem CID | 67576474 |
| Molecular Formula | C13H13BBrNO2 |
| Molecular Weight | 305.97 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 7-bromo-2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-1H-indole |
| SMILES | C=C1OB(c2cc3cccc(Br)c3[nH]2)OC1(C)C |
| InChI | InChI=1S/C13H13BBrNO2/c1-8-13(2,3)18-14(17-8)11-7-9-5-4-6-10(15)12(9)16-11/h4-7,16H,1H2,2-3H3 |
| InChIKey | HMPCTDKJOYDXQH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.97 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|