C15H18BFO4 — CID 89298556
methyl 3-[5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-fluorophenyl]propanoate (PubChem CID 89298556) has the molecular formula C15H18BFO4 and a molecular weight of 292.12 g/mol. Its IUPAC name is methyl 3-[5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-fluorophenyl]propanoate.
| Compound Name | methyl 3-[5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 89298556 |
| Molecular Formula | C15H18BFO4 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | methyl 3-[5-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-fluorophenyl]propanoate |
| SMILES | C=C1OB(c2ccc(F)c(CCC(=O)OC)c2)OC1(C)C |
| InChI | InChI=1S/C15H18BFO4/c1-10-15(2,3)21-16(20-10)12-6-7-13(17)11(9-12)5-8-14(18)19-4/h6-7,9H,1,5,8H2,2-4H3 |
| InChIKey | MDJITWFPQADKBW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|