C14H17FO3 — CID 140666165
methyl 3-(2-cyclopropyl-4-fluoro-3-methoxyphenyl)propanoate (PubChem CID 140666165) has the molecular formula C14H17FO3 and a molecular weight of 252.28 g/mol. Its IUPAC name is methyl 3-(2-cyclopropyl-4-fluoro-3-methoxyphenyl)propanoate.
| Compound Name | methyl 3-(2-cyclopropyl-4-fluoro-3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 140666165 |
| Molecular Formula | C14H17FO3 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | methyl 3-(2-cyclopropyl-4-fluoro-3-methoxyphenyl)propanoate |
| SMILES | COC(=O)CCc1ccc(F)c(OC)c1C1CC1 |
| InChI | InChI=1S/C14H17FO3/c1-17-12(16)8-6-10-5-7-11(15)14(18-2)13(10)9-3-4-9/h5,7,9H,3-4,6,8H2,1-2H3 |
| InChIKey | RXQUAOZDAYDRPU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |