C19H21N3O2 — CID 143951459
N-(2-amino-4H-3,1-benzoxazin-6-yl)acetamide;2,3-dihydro-1H-indene (PubChem CID 143951459) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-(2-amino-4H-3,1-benzoxazin-6-yl)acetamide;2,3-dihydro-1H-indene.
| Compound Name | N-(2-amino-4H-3,1-benzoxazin-6-yl)acetamide;2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 143951459 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-(2-amino-4H-3,1-benzoxazin-6-yl)acetamide;2,3-dihydro-1H-indene |
| SMILES | CC(=O)Nc1ccc2c(c1)COC(N)=N2.c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C10H11N3O2.C9H10/c1-6(14)12-8-2-3-9-7(4-8)5-15-10(11)13-9;1-2-5-9-7-3-6-8(9)4-1/h2-4H,5H2,1H3,(H2,11,13)(H,12,14);1-2,4-5H,3,6-7H2 |
| InChIKey | XMPBCTIKFMPOGJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |