C25H30AsN4O2 — CID 87311759
CID 87311759 (PubChem CID 87311759) has the molecular formula C25H30AsN4O2 and a molecular weight of 493.46 g/mol.
| Compound Name | CID 87311759 |
|---|---|
| PubChem CID | 87311759 |
| Molecular Formula | C25H30AsN4O2 |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | — |
| SMILES | CN1CCN(CC(=O)Nc2ccc3c(c2)COC([As][C@@H]2CCCc4ccccc42)=N3)CC1 |
| InChI | InChI=1S/C25H30AsN4O2/c1-29-11-13-30(14-12-29)16-24(31)27-20-9-10-23-19(15-20)17-32-25(28-23)26-22-8-4-6-18-5-2-3-7-21(18)22/h2-3,5,7,9-10,15,22H,4,6,8,11-14,16-17H2,1H3,(H,27,31)/t22-/m1/s1 |
| InChIKey | JPPWNZTYQAHVLN-JOCHJYFZSA-N |
| XLogP | 3.17 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|