C20H26N4O2 — CID 126739807
tert-butyl N-[(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamate (PubChem CID 126739807) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 126739807 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | tert-butyl N-[(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamate |
| SMILES | C=CC[C@H](NC(=O)OC(C)(C)C)c1cc(-c2ccc(N)cc2N)ccn1 |
| InChI | InChI=1S/C20H26N4O2/c1-5-6-17(24-19(25)26-20(2,3)4)18-11-13(9-10-23-18)15-8-7-14(21)12-16(15)22/h5,7-12,17H,1,6,21-22H2,2-4H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | SUQIAALKCPZERD-KRWDZBQOSA-N |
| XLogP | 4.05 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|