C20H23FN2O2 — CID 129080430
tert-butyl 2-[4-(2-amino-5-fluorophenyl)-2-pyridinyl]pent-4-enoate (PubChem CID 129080430) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is tert-butyl 2-[4-(2-amino-5-fluorophenyl)-2-pyridinyl]pent-4-enoate.
| Compound Name | tert-butyl 2-[4-(2-amino-5-fluorophenyl)-2-pyridinyl]pent-4-enoate |
|---|---|
| PubChem CID | 129080430 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | tert-butyl 2-[4-(2-amino-5-fluorophenyl)-2-pyridinyl]pent-4-enoate |
| SMILES | C=CCC(C(=O)OC(C)(C)C)c1cc(-c2cc(F)ccc2N)ccn1 |
| InChI | InChI=1S/C20H23FN2O2/c1-5-6-15(19(24)25-20(2,3)4)18-11-13(9-10-23-18)16-12-14(21)7-8-17(16)22/h5,7-12,15H,1,6,22H2,2-4H3 |
| InChIKey | GBTRFLADJNTOOX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|