C23H25FN2O4 — CID 129080423
2-[4-[2-[(1-ethoxy-5-oxopent-4-en-2-yl)amino]-5-fluorophenyl]-2-pyridinyl]pent-4-enoic acid (PubChem CID 129080423) has the molecular formula C23H25FN2O4 and a molecular weight of 412.46 g/mol. Its IUPAC name is 2-[4-[2-[(1-ethoxy-5-oxopent-4-en-2-yl)amino]-5-fluorophenyl]-2-pyridinyl]pent-4-enoic acid.
| Compound Name | 2-[4-[2-[(1-ethoxy-5-oxopent-4-en-2-yl)amino]-5-fluorophenyl]-2-pyridinyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 129080423 |
| Molecular Formula | C23H25FN2O4 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 2-[4-[2-[(1-ethoxy-5-oxopent-4-en-2-yl)amino]-5-fluorophenyl]-2-pyridinyl]pent-4-enoic acid |
| SMILES | C=CCC(C(=O)O)c1cc(-c2cc(F)ccc2NC(CC=C=O)COCC)ccn1 |
| InChI | InChI=1S/C23H25FN2O4/c1-3-6-19(23(28)29)22-13-16(10-11-25-22)20-14-17(24)8-9-21(20)26-18(7-5-12-27)15-30-4-2/h3,5,8-11,13-14,18-19,26H,1,4,6-7,15H2,2H3,(H,28,29) |
| InChIKey | HINYDSHBOOIKLM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|