C21H28FN3O3 — CID 126739831
tert-butyl 2-[(3S)-3-amino-3-[4-(2-amino-5-fluorophenyl)-2-pyridinyl]propoxy]propanoate (PubChem CID 126739831) has the molecular formula C21H28FN3O3 and a molecular weight of 389.47 g/mol. Its IUPAC name is tert-butyl 2-[(3S)-3-amino-3-[4-(2-amino-5-fluorophenyl)-2-pyridinyl]propoxy]propanoate.
| Compound Name | tert-butyl 2-[(3S)-3-amino-3-[4-(2-amino-5-fluorophenyl)-2-pyridinyl]propoxy]propanoate |
|---|---|
| PubChem CID | 126739831 |
| Molecular Formula | C21H28FN3O3 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | tert-butyl 2-[(3S)-3-amino-3-[4-(2-amino-5-fluorophenyl)-2-pyridinyl]propoxy]propanoate |
| SMILES | CC(OCC[C@H](N)c1cc(-c2cc(F)ccc2N)ccn1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H28FN3O3/c1-13(20(26)28-21(2,3)4)27-10-8-18(24)19-11-14(7-9-25-19)16-12-15(22)5-6-17(16)23/h5-7,9,11-13,18H,8,10,23-24H2,1-4H3/t13?,18-/m0/s1 |
| InChIKey | KASJXSJQDCABQB-UWBLVGDVSA-N |
| XLogP | 3.61 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|