C20H25FN2O2 — CID 71256566
tert-butyl N-butan-2-yl-N-[4-(3-fluorophenyl)-2-pyridinyl]carbamate (PubChem CID 71256566) has the molecular formula C20H25FN2O2 and a molecular weight of 344.43 g/mol. Its IUPAC name is tert-butyl N-butan-2-yl-N-[4-(3-fluorophenyl)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-butan-2-yl-N-[4-(3-fluorophenyl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 71256566 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | tert-butyl N-butan-2-yl-N-[4-(3-fluorophenyl)-2-pyridinyl]carbamate |
| SMILES | CCC(C)N(C(=O)OC(C)(C)C)c1cc(-c2cccc(F)c2)ccn1 |
| InChI | InChI=1S/C20H25FN2O2/c1-6-14(2)23(19(24)25-20(3,4)5)18-13-16(10-11-22-18)15-8-7-9-17(21)12-15/h7-14H,6H2,1-5H3 |
| InChIKey | WLAPKCIPGSIVEM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |