C13H19ClN2O3 — CID 87687103
tert-butyl N-(6-chloro-2-pyridinyl)-N-(1-hydroxypropan-2-yl)carbamate (PubChem CID 87687103) has the molecular formula C13H19ClN2O3 and a molecular weight of 286.76 g/mol. Its IUPAC name is tert-butyl N-(6-chloro-2-pyridinyl)-N-(1-hydroxypropan-2-yl)carbamate.
| Compound Name | tert-butyl N-(6-chloro-2-pyridinyl)-N-(1-hydroxypropan-2-yl)carbamate |
|---|---|
| PubChem CID | 87687103 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | tert-butyl N-(6-chloro-2-pyridinyl)-N-(1-hydroxypropan-2-yl)carbamate |
| SMILES | CC(CO)N(C(=O)OC(C)(C)C)c1cccc(Cl)n1 |
| InChI | InChI=1S/C13H19ClN2O3/c1-9(8-17)16(12(18)19-13(2,3)4)11-7-5-6-10(14)15-11/h5-7,9,17H,8H2,1-4H3 |
| InChIKey | ZNWVVBSYYSKIIO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|