C19H29NO6 — CID 70185068
tert-butyl [4-[[(2S)-1-hydroxypropan-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl] carbonate (PubChem CID 70185068) has the molecular formula C19H29NO6 and a molecular weight of 367.44 g/mol. Its IUPAC name is tert-butyl [4-[[(2S)-1-hydroxypropan-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl] carbonate.
| Compound Name | tert-butyl [4-[[(2S)-1-hydroxypropan-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl] carbonate |
|---|---|
| PubChem CID | 70185068 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | tert-butyl [4-[[(2S)-1-hydroxypropan-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl] carbonate |
| SMILES | C[C@@H](CO)N(C(=O)OC(C)(C)C)c1ccc(OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H29NO6/c1-13(12-21)20(16(22)25-18(2,3)4)14-8-10-15(11-9-14)24-17(23)26-19(5,6)7/h8-11,13,21H,12H2,1-7H3/t13-/m0/s1 |
| InChIKey | TVAGSPDYTLASGS-ZDUSSCGKSA-N |
| XLogP | 4.12 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|