C23H28FN3O4 — CID 135620554
tert-butyl N-[4-[(E)-C-(4-fluorobenzoyl)-N-hydroxycarbonimidoyl]-2-pyridinyl]-N-(3-methylbutan-2-yl)carbamate (PubChem CID 135620554) has the molecular formula C23H28FN3O4 and a molecular weight of 429.49 g/mol. Its IUPAC name is tert-butyl N-[4-[(E)-C-(4-fluorobenzoyl)-N-hydroxycarbonimidoyl]-2-pyridinyl]-N-(3-methylbutan-2-yl)carbamate.
| Compound Name | tert-butyl N-[4-[(E)-C-(4-fluorobenzoyl)-N-hydroxycarbonimidoyl]-2-pyridinyl]-N-(3-methylbutan-2-yl)carbamate |
|---|---|
| PubChem CID | 135620554 |
| Molecular Formula | C23H28FN3O4 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | tert-butyl N-[4-[(E)-C-(4-fluorobenzoyl)-N-hydroxycarbonimidoyl]-2-pyridinyl]-N-(3-methylbutan-2-yl)carbamate |
| SMILES | CC(C)C(C)N(C(=O)OC(C)(C)C)c1cc(/C(=N\O)C(=O)c2ccc(F)cc2)ccn1 |
| InChI | InChI=1S/C23H28FN3O4/c1-14(2)15(3)27(22(29)31-23(4,5)6)19-13-17(11-12-25-19)20(26-30)21(28)16-7-9-18(24)10-8-16/h7-15,30H,1-6H3/b26-20+ |
| InChIKey | JGJDUEOCUNOZBW-LHLOQNFPSA-N |
| XLogP | 5.07 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|