C22H26FN3O4 — CID 135620553
tert-butyl N-[4-[(E)-C-(4-fluorobenzoyl)-N-hydroxycarbonimidoyl]-2-pyridinyl]-N-(2-methylpropyl)carbamate (PubChem CID 135620553) has the molecular formula C22H26FN3O4 and a molecular weight of 415.47 g/mol. Its IUPAC name is tert-butyl N-[4-[(E)-C-(4-fluorobenzoyl)-N-hydroxycarbonimidoyl]-2-pyridinyl]-N-(2-methylpropyl)carbamate.
| Compound Name | tert-butyl N-[4-[(E)-C-(4-fluorobenzoyl)-N-hydroxycarbonimidoyl]-2-pyridinyl]-N-(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 135620553 |
| Molecular Formula | C22H26FN3O4 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | tert-butyl N-[4-[(E)-C-(4-fluorobenzoyl)-N-hydroxycarbonimidoyl]-2-pyridinyl]-N-(2-methylpropyl)carbamate |
| SMILES | CC(C)CN(C(=O)OC(C)(C)C)c1cc(/C(=N\O)C(=O)c2ccc(F)cc2)ccn1 |
| InChI | InChI=1S/C22H26FN3O4/c1-14(2)13-26(21(28)30-22(3,4)5)18-12-16(10-11-24-18)19(25-29)20(27)15-6-8-17(23)9-7-15/h6-12,14,29H,13H2,1-5H3/b25-19+ |
| InChIKey | HXZJKFHYNZRCOA-NCELDCMTSA-N |
| XLogP | 4.68 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|