C23H26FN3O5 — CID 135620577
tert-butyl N-[4-[(E)-C-(4-fluorobenzoyl)-N-hydroxycarbonimidoyl]-2-pyridinyl]-N-(oxan-4-yl)carbamate (PubChem CID 135620577) has the molecular formula C23H26FN3O5 and a molecular weight of 443.48 g/mol. Its IUPAC name is tert-butyl N-[4-[(E)-C-(4-fluorobenzoyl)-N-hydroxycarbonimidoyl]-2-pyridinyl]-N-(oxan-4-yl)carbamate.
| Compound Name | tert-butyl N-[4-[(E)-C-(4-fluorobenzoyl)-N-hydroxycarbonimidoyl]-2-pyridinyl]-N-(oxan-4-yl)carbamate |
|---|---|
| PubChem CID | 135620577 |
| Molecular Formula | C23H26FN3O5 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | tert-butyl N-[4-[(E)-C-(4-fluorobenzoyl)-N-hydroxycarbonimidoyl]-2-pyridinyl]-N-(oxan-4-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1cc(/C(=N\O)C(=O)c2ccc(F)cc2)ccn1)C1CCOCC1 |
| InChI | InChI=1S/C23H26FN3O5/c1-23(2,3)32-22(29)27(18-9-12-31-13-10-18)19-14-16(8-11-25-19)20(26-30)21(28)15-4-6-17(24)7-5-15/h4-8,11,14,18,30H,9-10,12-13H2,1-3H3/b26-20+ |
| InChIKey | KLYVKDBIEHLGEP-LHLOQNFPSA-N |
| XLogP | 4.20 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|