C16H15FN2O2 — CID 129080452
2-[4-(2-amino-5-fluorophenyl)-2-pyridinyl]pent-4-enoic acid (PubChem CID 129080452) has the molecular formula C16H15FN2O2 and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-[4-(2-amino-5-fluorophenyl)-2-pyridinyl]pent-4-enoic acid.
| Compound Name | 2-[4-(2-amino-5-fluorophenyl)-2-pyridinyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 129080452 |
| Molecular Formula | C16H15FN2O2 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-[4-(2-amino-5-fluorophenyl)-2-pyridinyl]pent-4-enoic acid |
| SMILES | C=CCC(C(=O)O)c1cc(-c2cc(F)ccc2N)ccn1 |
| InChI | InChI=1S/C16H15FN2O2/c1-2-3-12(16(20)21)15-8-10(6-7-19-15)13-9-11(17)4-5-14(13)18/h2,4-9,12H,1,3,18H2,(H,20,21) |
| InChIKey | LAMVGUOZCGVULM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|