C21H23N3O6 — CID 90313532
2-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl]-4-pyridinyl]-5-nitrobenzoic acid (PubChem CID 90313532) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is 2-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl]-4-pyridinyl]-5-nitrobenzoic acid.
| Compound Name | 2-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl]-4-pyridinyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 90313532 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl]-4-pyridinyl]-5-nitrobenzoic acid |
| SMILES | C=CCC(NC(=O)OC(C)(C)C)c1cc(-c2ccc([N+](=O)[O-])cc2C(=O)O)ccn1 |
| InChI | InChI=1S/C21H23N3O6/c1-5-6-17(23-20(27)30-21(2,3)4)18-11-13(9-10-22-18)15-8-7-14(24(28)29)12-16(15)19(25)26/h5,7-12,17H,1,6H2,2-4H3,(H,23,27)(H,25,26) |
| InChIKey | RDZWCJHPDHDCIB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 131.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|