C21H27F2N5O6 — CID 163255731
(2R,6S)-6-[4-[1-(difluoromethyl)-4-nitropyrazol-5-yl]-2-pyridinyl]-2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 163255731) has the molecular formula C21H27F2N5O6 and a molecular weight of 483.47 g/mol. Its IUPAC name is (2R,6S)-6-[4-[1-(difluoromethyl)-4-nitropyrazol-5-yl]-2-pyridinyl]-2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (2R,6S)-6-[4-[1-(difluoromethyl)-4-nitropyrazol-5-yl]-2-pyridinyl]-2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 163255731 |
| Molecular Formula | C21H27F2N5O6 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | (2R,6S)-6-[4-[1-(difluoromethyl)-4-nitropyrazol-5-yl]-2-pyridinyl]-2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | C[C@H](CCC[C@H](NC(=O)OC(C)(C)C)c1cc(-c2c([N+](=O)[O-])cnn2C(F)F)ccn1)C(=O)O |
| InChI | InChI=1S/C21H27F2N5O6/c1-12(18(29)30)6-5-7-14(26-20(31)34-21(2,3)4)15-10-13(8-9-24-15)17-16(28(32)33)11-25-27(17)19(22)23/h8-12,14,19H,5-7H2,1-4H3,(H,26,31)(H,29,30)/t12-,14+/m1/s1 |
| InChIKey | DNLCKHCUAYSQFW-OCCSQVGLSA-N |
| XLogP | 4.71 |
| TPSA | 149.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|