C22H27F2N5O3 — CID 118277226
tert-butyl N-[(1S)-1-[4-[4-(but-3-enoylamino)-1-(difluoromethyl)pyrazol-5-yl]-2-pyridinyl]but-3-enyl]carbamate (PubChem CID 118277226) has the molecular formula C22H27F2N5O3 and a molecular weight of 447.49 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[4-[4-(but-3-enoylamino)-1-(difluoromethyl)pyrazol-5-yl]-2-pyridinyl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[4-[4-(but-3-enoylamino)-1-(difluoromethyl)pyrazol-5-yl]-2-pyridinyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 118277226 |
| Molecular Formula | C22H27F2N5O3 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | tert-butyl N-[(1S)-1-[4-[4-(but-3-enoylamino)-1-(difluoromethyl)pyrazol-5-yl]-2-pyridinyl]but-3-enyl]carbamate |
| SMILES | C=CCC(=O)Nc1cnn(C(F)F)c1-c1ccnc([C@H](CC=C)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H27F2N5O3/c1-6-8-15(28-21(31)32-22(3,4)5)16-12-14(10-11-25-16)19-17(27-18(30)9-7-2)13-26-29(19)20(23)24/h6-7,10-13,15,20H,1-2,8-9H2,3-5H3,(H,27,30)(H,28,31)/t15-/m0/s1 |
| InChIKey | ZLXNPGMDOFHFQZ-HNNXBMFYSA-N |
| XLogP | 5.00 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|